CAS 641-74-7 appears in our catalog under these names: Isomannide, 1,4:3,6-Dianhydro-D-mannitol, 1,4：3,6–Dianhydro–D–mannitol, Isomannide, >98.0%(GC), Isomannide 97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 1g, 25g, 5g, 100g, 500g, 250g, 2000g.
(3R,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol (CAS 641-74-7) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (3R,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol. InChIKey: KLDXJTOLSGUMSJ-KVTDHHQDSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (3R,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol |
| InChIKey | KLDXJTOLSGUMSJ-KVTDHHQDSA-N |
| SMILES | C1[C@H]([C@@H]2[C@H](O1)[C@@H](CO2)O)O |
Computed by PubChem (NCBI)