CAS 24332-71-6 appears in our catalog under these names: L-Isoidide, 1,4:3,6-Dianhydro-L-iditol, (3S,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diol 97%, (3S,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diol, 97%, 97%, (3S,3aR,6S,6aR)-Hexahydro-furo[3,2-b]furan-3,6-diol. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 0,05g, 0,025g, 0,1g, 0,5g, 0,25g, 50mg, 100mg.
(3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol (CAS 24332-71-6) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol. InChIKey: KLDXJTOLSGUMSJ-UNTFVMJOSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (3S,3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol |
| InChIKey | KLDXJTOLSGUMSJ-UNTFVMJOSA-N |
| SMILES | C1[C@@H]([C@@H]2[C@H](O1)[C@H](CO2)O)O |
Computed by PubChem (NCBI)