Products 1245131-14-9
CAS 1245131-14-9 is the registry number for 3-(Chloromethyl)-5-(2-naphthalenyl)isoxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(chloromethyl)-5-naphthalen-2-yl-1,2-oxazole (CAS 1245131-14-9) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 3-(chloromethyl)-5-naphthalen-2-yl-1,2-oxazole. InChIKey: XSTGYAWYMVWSLI-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(chloromethyl)-5-naphthalen-2-yl-1,2-oxazole |
| InChIKey | XSTGYAWYMVWSLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC(=NO3)CCl |
Computed by PubChem (NCBI)