CAS 124522-52-7 is the registry number for N-(2-Benzoylphenyl)-2-pyridinecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2-benzoylphenyl)pyridine-2-carboxamide (CAS 124522-52-7) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: N-(2-benzoylphenyl)pyridine-2-carboxamide. InChIKey: YSMRJHHJXKEKFX-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | N-(2-benzoylphenyl)pyridine-2-carboxamide |
| InChIKey | YSMRJHHJXKEKFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2NC(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)