CAS 956986-58-6 is the registry number for 3-(1-Benzofuran-2-yl)-1-benzyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(1-benzofuran-2-yl)-1-benzylpyrazole-4-carbaldehyde (CAS 956986-58-6) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: 3-(1-benzofuran-2-yl)-1-benzylpyrazole-4-carbaldehyde. InChIKey: HBRRKHIEUQLAJW-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-(1-benzofuran-2-yl)-1-benzylpyrazole-4-carbaldehyde |
| InChIKey | HBRRKHIEUQLAJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(=N2)C3=CC4=CC=CC=C4O3)C=O |
Computed by PubChem (NCBI)