CAS 60986-80-3 appears in our catalog under these names: 5-Methyl-3,6-diphenylisoxazolo[4,5-c]pyridin-4(5H)-one, 97%, mGluR7 antagonist-2. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
5-methyl-3,6-diphenyl-[1,2]oxazolo[4,5-c]pyridin-4-one (CAS 60986-80-3) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: 5-methyl-3,6-diphenyl-[1,2]oxazolo[4,5-c]pyridin-4-one. InChIKey: LCNDUGHNYMJGIW-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 5-methyl-3,6-diphenyl-[1,2]oxazolo[4,5-c]pyridin-4-one |
| InChIKey | LCNDUGHNYMJGIW-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C(C1=O)C(=NO2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)