Products 1245272-40-5

CAS 1245272-40-5 is the registry number for Ethyl 5-bromo-1-tert-butyl-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate (CAS 1245272-40-5) is a chemical compound with the molecular formula C10H15BrN2O2 and a molecular weight of 275.14 g/mol. IUPAC name: ethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate. InChIKey: RSUGKABMEVWWKL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BrN2O2
Molecular weight275.14 g/mol
IUPAC nameethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate
InChIKeyRSUGKABMEVWWKL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(N=C1)C(C)(C)C)Br

Computed by PubChem (NCBI)