CAS 1245272-40-5 is the registry number for Ethyl 5-bromo-1-tert-butyl-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate (CAS 1245272-40-5) is a chemical compound with the molecular formula C10H15BrN2O2 and a molecular weight of 275.14 g/mol. IUPAC name: ethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate. InChIKey: RSUGKABMEVWWKL-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2O2 |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | ethyl 5-bromo-1-tert-butylpyrazole-4-carboxylate |
| InChIKey | RSUGKABMEVWWKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C(C)(C)C)Br |
Computed by PubChem (NCBI)