Products 2386203-91-2
CAS 2386203-91-2 is the registry number for tert-Butyl 4-(2-bromoethyl)-1H-pyrazole-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(2-bromoethyl)pyrazole-1-carboxylate (CAS 2386203-91-2) is a chemical compound with the molecular formula C10H15BrN2O2 and a molecular weight of 275.14 g/mol. IUPAC name: tert-butyl 4-(2-bromoethyl)pyrazole-1-carboxylate. InChIKey: ROGVWUIEUSETSQ-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN2O2 |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | tert-butyl 4-(2-bromoethyl)pyrazole-1-carboxylate |
| InChIKey | ROGVWUIEUSETSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)CCBr |
Computed by PubChem (NCBI)