CAS 2432829-32-6 is the registry number for (1S,2S,6R)-6-(4-Bromo-1H-pyrazol-1-yl)-1-methylcyclohexane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,6R)-6-(4-bromopyrazol-1-yl)-1-methylcyclohexane-1,2-diol (CAS 2432829-32-6) is a chemical compound with the molecular formula C10H15BrN2O2 and a molecular weight of 275.14 g/mol. IUPAC name: (1S,2S,6R)-6-(4-bromopyrazol-1-yl)-1-methylcyclohexane-1,2-diol. InChIKey: VVHOZMMSJZKPMF-UTLUCORTSA-N.
| Molecular formula | C10H15BrN2O2 |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | (1S,2S,6R)-6-(4-bromopyrazol-1-yl)-1-methylcyclohexane-1,2-diol |
| InChIKey | VVHOZMMSJZKPMF-UTLUCORTSA-N |
| SMILES | C[C@@]1([C@@H](CCC[C@@H]1O)N2C=C(C=N2)Br)O |
Computed by PubChem (NCBI)