CAS 1245523-49-2 appears in our catalog under these names: tert-Butyl 6'-bromo-1'-oxo-1',3'-dihydrospiro(azetidine-3,2'-indene)-1-carboxylate, 98%, 1-Boc-6’-bromo-1’-oxo-1’,3’-dihydrospiro[azetidine-3,2’-indene], ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl 5-bromo-3-oxospiro[1H-indene-2,3'-azetidine]-1'-carboxylate (CAS 1245523-49-2) is a chemical compound with the molecular formula C16H18BrNO3 and a molecular weight of 352.22 g/mol. IUPAC name: tert-butyl 5-bromo-3-oxospiro[1H-indene-2,3'-azetidine]-1'-carboxylate. InChIKey: LKZLCGZPGGWTSC-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO3 |
|---|---|
| Molecular weight | 352.22 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-oxospiro[1H-indene-2,3'-azetidine]-1'-carboxylate |
| InChIKey | LKZLCGZPGGWTSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)