Products 105990-27-0
CAS 105990-27-0 appears in our catalog under these names: (S)-(-)-Higenamine Hydrobromide, >95% (HPLC), (S)–Higenamine hydrobromide, (S)-(-)-Higenamine hydrobromide, (S)-Higenamine (hydrobromide), 97.85%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 25mg, 10mg, 50mg, 1 mg.
(1S)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (CAS 105990-27-0) is a chemical compound with the molecular formula C16H18BrNO3 and a molecular weight of 352.22 g/mol. IUPAC name: (1S)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide. InChIKey: KNUKFIRMGSQPEM-UQKRIMTDSA-N.
| Molecular formula | C16H18BrNO3 |
|---|---|
| Molecular weight | 352.22 g/mol |
| IUPAC name | (1S)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| InChIKey | KNUKFIRMGSQPEM-UQKRIMTDSA-N |
| SMILES | C1CN[C@H](C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O.Br |
Computed by PubChem (NCBI)