CAS 63604-85-3 is the registry number for Higenamine Hydrobromide Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (CAS 63604-85-3) is a chemical compound with the molecular formula C16H18BrNO3 and a molecular weight of 352.22 g/mol. IUPAC name: 1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide. InChIKey: KNUKFIRMGSQPEM-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO3 |
|---|---|
| Molecular weight | 352.22 g/mol |
| IUPAC name | 1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| InChIKey | KNUKFIRMGSQPEM-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O.Br |
Computed by PubChem (NCBI)