Products 1245529-08-1
CAS 1245529-08-1 is the registry number for 2-Hydroxy-3,4-dimethyl-5-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3,4-dimethyl-5-nitrobenzoic acid (CAS 1245529-08-1) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-hydroxy-3,4-dimethyl-5-nitrobenzoic acid. InChIKey: BLNIDZCASLLVTR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-hydroxy-3,4-dimethyl-5-nitrobenzoic acid |
| InChIKey | BLNIDZCASLLVTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1C)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)