CAS 1245532-88-0 appears in our catalog under these names: 3-Bromo-2-methoxy-4,5-dimethylbenzoic acid, 95%, 3-Bromo-2-methoxy-4,5-dimethyl-benzoic Acid, 3-Bromo-2-methoxy-4,5-dimethylbenzoic acid, 97%, 2–Methoxy–3–bromo–4,5–dimethylbenzoic acid, 3-Bromo-2-methoxy-4,5-dimethylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 2,5g, 100mg, 5g, 500mg, 10g.
3-bromo-2-methoxy-4,5-dimethylbenzoic acid (CAS 1245532-88-0) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-2-methoxy-4,5-dimethylbenzoic acid. InChIKey: ZOFXLYROINAVAZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromo-2-methoxy-4,5-dimethylbenzoic acid |
| InChIKey | ZOFXLYROINAVAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)Br)OC)C(=O)O |
Computed by PubChem (NCBI)