CAS 1245623-77-1 appears in our catalog under these names: (R)–3–(1–Amino–2–hydroxyethyl)benzonitrile hydrochloride, (R)-3-(1-Amino-2-hydroxyethyl)benzonitrile hydrochloride, 95%, (R)-3-(1-Amino-2-hydroxyethyl)benzonitrile hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[(1R)-1-amino-2-hydroxyethyl]benzonitrile;hydrochloride (CAS 1245623-77-1) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 3-[(1R)-1-amino-2-hydroxyethyl]benzonitrile;hydrochloride. InChIKey: SHCGXNAWGYFVRX-FVGYRXGTSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 3-[(1R)-1-amino-2-hydroxyethyl]benzonitrile;hydrochloride |
| InChIKey | SHCGXNAWGYFVRX-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC(=C1)[C@H](CO)N)C#N.Cl |
Computed by PubChem (NCBI)