CAS 2089377-63-7 appears in our catalog under these names: 3-(1-Amino-2-hydroxyethyl)-Benzonitrile Hydrochloride, 3-(1-Amino-2-hydroxyethyl)benzonitrile hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg.
3-(1-amino-2-hydroxyethyl)benzonitrile;hydrochloride (CAS 2089377-63-7) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 3-(1-amino-2-hydroxyethyl)benzonitrile;hydrochloride. InChIKey: SHCGXNAWGYFVRX-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 3-(1-amino-2-hydroxyethyl)benzonitrile;hydrochloride |
| InChIKey | SHCGXNAWGYFVRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(CO)N)C#N.Cl |
Computed by PubChem (NCBI)