Products 1245646-55-2
CAS 1245646-55-2 is the registry number for (4,6-Dichloropyrimidin-5-yl)(4-methoxyphenyl)methanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
(4,6-dichloropyrimidin-5-yl)-(4-methoxyphenyl)methanone (CAS 1245646-55-2) is a chemical compound with the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. IUPAC name: (4,6-dichloropyrimidin-5-yl)-(4-methoxyphenyl)methanone. InChIKey: SLUQGTXCJRSZIH-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | (4,6-dichloropyrimidin-5-yl)-(4-methoxyphenyl)methanone |
| InChIKey | SLUQGTXCJRSZIH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(N=CN=C2Cl)Cl |
Computed by PubChem (NCBI)