CAS 663611-49-2 appears in our catalog under these names: 4-(2,5-Dichloropyrimidin-4-yl)benzoic acid methyl ester, 95%, Methyl 4-(2,5-dichloro-4-pyrimidinyl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 4-(2,5-dichloropyrimidin-4-yl)benzoate (CAS 663611-49-2) is a chemical compound with the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. IUPAC name: methyl 4-(2,5-dichloropyrimidin-4-yl)benzoate. InChIKey: DZBSNQZZBQKBBN-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | methyl 4-(2,5-dichloropyrimidin-4-yl)benzoate |
| InChIKey | DZBSNQZZBQKBBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)