CAS 57978-49-1 appears in our catalog under these names: 2-((3,4-Dichlorophenyl)amino)pyridine-3-carboxylic acid, 95%, 2-((3,4-Dichlorophenyl)amino)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3,4-dichloroanilino)pyridine-3-carboxylic acid (CAS 57978-49-1) is a chemical compound with the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. IUPAC name: 2-(3,4-dichloroanilino)pyridine-3-carboxylic acid. InChIKey: FJBJORSODLVTLR-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 2-(3,4-dichloroanilino)pyridine-3-carboxylic acid |
| InChIKey | FJBJORSODLVTLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)