CAS 1245648-51-4 is the registry number for 3-Methoxy-6-nitropyridin-2-ol, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
3-methoxy-6-nitro-1H-pyridin-2-one (CAS 1245648-51-4) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 3-methoxy-6-nitro-1H-pyridin-2-one. InChIKey: DTCBKUGKCBDPNG-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 3-methoxy-6-nitro-1H-pyridin-2-one |
| InChIKey | DTCBKUGKCBDPNG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(NC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)