Products 1245823-61-3
CAS 1245823-61-3 appears in our catalog under these names: 1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 95%, 1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-ethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride (CAS 1245823-61-3) is a chemical compound with the molecular formula C6H6ClF3N2O2S and a molecular weight of 262.64 g/mol. IUPAC name: 1-ethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride. InChIKey: FYMRKWVJFUASFG-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2O2S |
|---|---|
| Molecular weight | 262.64 g/mol |
| IUPAC name | 1-ethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride |
| InChIKey | FYMRKWVJFUASFG-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)