CAS 2091430-99-6 appears in our catalog under these names: (1-(2,2,2-Trifluoroethyl)-1H-pyrazol-3-yl)methanesulfonyl chloride, 95%, (1-(2,2,2-Trifluoroethyl)-1H-pyrazol-3-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonyl chloride (CAS 2091430-99-6) is a chemical compound with the molecular formula C6H6ClF3N2O2S and a molecular weight of 262.64 g/mol. IUPAC name: [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonyl chloride. InChIKey: UPKTWUKEAPGRGX-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2O2S |
|---|---|
| Molecular weight | 262.64 g/mol |
| IUPAC name | [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonyl chloride |
| InChIKey | UPKTWUKEAPGRGX-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1CS(=O)(=O)Cl)CC(F)(F)F |
Computed by PubChem (NCBI)