CAS 88398-42-9 appears in our catalog under these names: 1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 98%, 98%, 1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 98%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 0,5g, 100mg, 1g, 250mg.
1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride (CAS 88398-42-9) is a chemical compound with the molecular formula C6H6ClF3N2O2S and a molecular weight of 262.64 g/mol. IUPAC name: 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride. InChIKey: SPJVLXRHVVOZDR-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2O2S |
|---|---|
| Molecular weight | 262.64 g/mol |
| IUPAC name | 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride |
| InChIKey | SPJVLXRHVVOZDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)