Products 1246213-23-9
CAS 1246213-23-9 appears in our catalog under these names: Ivacaftor Impurity 2, Hydroxymethyl Ivacaftor, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
N-[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide (CAS 1246213-23-9) is a chemical compound with the molecular formula C24H28N2O4 and a molecular weight of 408.5 g/mol. IUPAC name: N-[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide. InChIKey: HFNOECBPRSJRQD-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O4 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | N-[2-tert-butyl-5-hydroxy-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| InChIKey | HFNOECBPRSJRQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1NC(=O)C2=CNC3=CC=CC=C3C2=O)O)C(C)(C)CO |
Computed by PubChem (NCBI)