Products 136152-64-2
CAS 136152-64-2 appears in our catalog under these names: (R)-Dimethindene Maleate, (R)–(+)–Dimethindene maleate, (R)-(+)-Dimethindene (maleate), 99%, 99%, (R)-(+)-Dimethindene (maleate), 99.94%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 25mg, 5mg, 50mg, 1mg, 10 mg.
(Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine (CAS 136152-64-2) is a chemical compound with the molecular formula C24H28N2O4 and a molecular weight of 408.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine. InChIKey: SWECWXGUJQLXJF-DASCVMRKSA-N.
| Molecular formula | C24H28N2O4 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1R)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine |
| InChIKey | SWECWXGUJQLXJF-DASCVMRKSA-N |
| SMILES | C[C@@H](C1=CC=CC=N1)C2=C(CC3=CC=CC=C32)CCN(C)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)