CAS 136152-65-3 appears in our catalog under these names: (S)-Dimethindene Maleate, (S)-(+)-Dimethindene Maleate, (S)–(+)–Dimethindene maleate, (S)-(+)-Dimethindene maleate/ 99.43% (existing batch purity), (S)-N,N-Dimethyl-2-(3-(1-(pyridin-2-yl)ethyl)-1H-inden-2-yl)ethanamine maleate, 99.94% ,, 99.94% ,. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Chemat. Available pack sizes: on request, 100mg, 1mg, 10mg, 5mg, 25mg, 2mg, 50 mg.
(Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1S)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine (CAS 136152-65-3) is a chemical compound with the molecular formula C24H28N2O4 and a molecular weight of 408.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1S)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine. InChIKey: SWECWXGUJQLXJF-HFNHQGOYSA-N.
| Molecular formula | C24H28N2O4 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N,N-dimethyl-2-[3-[(1S)-1-pyridin-2-ylethyl]-1H-inden-2-yl]ethanamine |
| InChIKey | SWECWXGUJQLXJF-HFNHQGOYSA-N |
| SMILES | C[C@H](C1=CC=CC=N1)C2=C(CC3=CC=CC=C32)CCN(C)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)