CAS 1246213-40-0 is the registry number for 6-Amino-5-(1,1-dimethylethyl)-3,3-dimethyl-2(3H)-benzofuranone. Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.
6-amino-5-tert-butyl-3,3-dimethyl-1-benzofuran-2-one (CAS 1246213-40-0) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 6-amino-5-tert-butyl-3,3-dimethyl-1-benzofuran-2-one. InChIKey: UVSSESLOSCZNRP-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 6-amino-5-tert-butyl-3,3-dimethyl-1-benzofuran-2-one |
| InChIKey | UVSSESLOSCZNRP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=C(C=C2OC1=O)N)C(C)(C)C)C |
Computed by PubChem (NCBI)