Products 1246304-34-6
CAS 1246304-34-6 appears in our catalog under these names: Sphingosine–d7 (d18：1), Sphingosine-d7, Sphingosine-d7 (d18:1), ≥99%, ≥99%, D-erythro-Sphingosine-d7, 99.00%. Offered by: GLPBio, Biosynth, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 500μg, 10mg, 5mg, 25mg, 50mg, 500 μg.
(E,2S,3R)-2-amino-16,16,17,17,18,18,18-heptadeuteriooctadec-4-ene-1,3-diol (CAS 1246304-34-6) is a chemical compound with the molecular formula C18H37NO2 and a molecular weight of 306.5 g/mol. IUPAC name: (E,2S,3R)-2-amino-16,16,17,17,18,18,18-heptadeuteriooctadec-4-ene-1,3-diol. InChIKey: WWUZIQQURGPMPG-AVMMVCTPSA-N.
| Molecular formula | C18H37NO2 |
|---|---|
| Molecular weight | 306.5 g/mol |
| IUPAC name | (E,2S,3R)-2-amino-16,16,17,17,18,18,18-heptadeuteriooctadec-4-ene-1,3-diol |
| InChIKey | WWUZIQQURGPMPG-AVMMVCTPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCCCC/C=C/[C@H]([C@H](CO)N)O |
Computed by PubChem (NCBI)