Products 2377379-55-8
CAS 2377379-55-8 appears in our catalog under these names: Sphingosine–d9 (d18：1), Sphingosine-d9 (d18:1). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
(E,2S,3R)-2-amino-15,15,16,16,17,17,18,18,18-nonadeuteriooctadec-4-ene-1,3-diol (CAS 2377379-55-8) is a chemical compound with the molecular formula C18H37NO2 and a molecular weight of 308.5 g/mol. IUPAC name: (E,2S,3R)-2-amino-15,15,16,16,17,17,18,18,18-nonadeuteriooctadec-4-ene-1,3-diol. InChIKey: WWUZIQQURGPMPG-ZVPCYXOTSA-N.
| Molecular formula | C18H37NO2 |
|---|---|
| Molecular weight | 308.5 g/mol |
| IUPAC name | (E,2S,3R)-2-amino-15,15,16,16,17,17,18,18,18-nonadeuteriooctadec-4-ene-1,3-diol |
| InChIKey | WWUZIQQURGPMPG-ZVPCYXOTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCCC/C=C/[C@H]([C@H](CO)N)O |
Computed by PubChem (NCBI)