CAS 1246442-45-4 appears in our catalog under these names: 1-tert-Butyl 3-methyl (3s,5r)-rel-5-hydroxypiperidine-1,3-dicarboxylate, 95%, rel-(3R,5S)-1-tert-Butyl 3-methyl 5-hydroxypiperidine-1,3-dicarboxylate 98%, 1-tert-butyl 3-methyl (3S,5R)-rel-5-hydroxypiperidine-1,3-dicarboxylate, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1-O-tert-butyl 3-O-methyl (3S,5R)-5-hydroxypiperidine-1,3-dicarboxylate (CAS 1246442-45-4) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,5R)-5-hydroxypiperidine-1,3-dicarboxylate. InChIKey: DFZMPKMSTNKZKL-DTWKUNHWSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,5R)-5-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | DFZMPKMSTNKZKL-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H](C1)O)C(=O)OC |
Computed by PubChem (NCBI)