CAS 1638765-16-8 appears in our catalog under these names: 1-tert-Butyl 3-methyl (3s,5s)-rel-5-hydroxypiperidine-1,3-dicarboxylate, 95%, Trans-1,3-piperidinedicarboxylic acid, 5-hydroxy-, 1-(1,1-dimethylethyl) 3-methyl ester, 97%, 1-tert-butyl 3-methyl (3S,5S)-rel-5-hydroxypiperidine-1,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
1-O-tert-butyl 3-O-methyl (3S,5S)-5-hydroxypiperidine-1,3-dicarboxylate (CAS 1638765-16-8) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,5S)-5-hydroxypiperidine-1,3-dicarboxylate. InChIKey: DFZMPKMSTNKZKL-IUCAKERBSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,5S)-5-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | DFZMPKMSTNKZKL-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H](C1)O)C(=O)OC |
Computed by PubChem (NCBI)