Products 1246542-68-6
CAS 1246542-68-6 is the registry number for Mirogabalin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate (CAS 1246542-68-6) is a chemical compound with the molecular formula C16H27NO2 and a molecular weight of 265.39 g/mol. IUPAC name: tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate. InChIKey: IZXVSXNNJJCZQI-XEZPLFJOSA-N.
| Molecular formula | C16H27NO2 |
|---|---|
| Molecular weight | 265.39 g/mol |
| IUPAC name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| InChIKey | IZXVSXNNJJCZQI-XEZPLFJOSA-N |
| SMILES | CCC1=C[C@H]2[C@@H](C1)C[C@]2(CC(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)