Products 2070015-15-3
CAS 2070015-15-3 appears in our catalog under these names: Mebeverine Alcohol-d5, Mebeverine alcohol D5, Mebeverine alcohol-d5, 98.0%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg.
4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butan-1-ol (CAS 2070015-15-3) is a chemical compound with the molecular formula C16H27NO2 and a molecular weight of 270.42 g/mol. IUPAC name: 4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butan-1-ol. InChIKey: ZGZAPRVKIAFOPL-SGEUAGPISA-N.
| Molecular formula | C16H27NO2 |
|---|---|
| Molecular weight | 270.42 g/mol |
| IUPAC name | 4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butan-1-ol |
| InChIKey | ZGZAPRVKIAFOPL-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCCCO)C(C)CC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)