CAS 870640-61-2 is the registry number for Monomethyl auristatin E intermediate-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S)-N-benzyl-1,1-dimethoxy-N,3-dimethylpentan-2-amine (CAS 870640-61-2) is a chemical compound with the molecular formula C16H27NO2 and a molecular weight of 265.39 g/mol. IUPAC name: (2S,3S)-N-benzyl-1,1-dimethoxy-N,3-dimethylpentan-2-amine. InChIKey: GYOWFCNRTAPUGL-ZFWWWQNUSA-N.
| Molecular formula | C16H27NO2 |
|---|---|
| Molecular weight | 265.39 g/mol |
| IUPAC name | (2S,3S)-N-benzyl-1,1-dimethoxy-N,3-dimethylpentan-2-amine |
| InChIKey | GYOWFCNRTAPUGL-ZFWWWQNUSA-N |
| SMILES | CC[C@H](C)[C@@H](C(OC)OC)N(C)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)