Products 1415817-43-4
CAS 1415817-43-4 is the registry number for Mirogabalin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate (CAS 1415817-43-4) is a chemical compound with the molecular formula C16H27NO2 and a molecular weight of 265.39 g/mol. IUPAC name: tert-butyl 2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate. InChIKey: IZXVSXNNJJCZQI-HEHGZKQESA-N.
| Molecular formula | C16H27NO2 |
|---|---|
| Molecular weight | 265.39 g/mol |
| IUPAC name | tert-butyl 2-[(1S,5R,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| InChIKey | IZXVSXNNJJCZQI-HEHGZKQESA-N |
| SMILES | CCC1=C[C@H]2[C@@H](C1)C[C@@]2(CC(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)
Synonyms:
Mirogabalin Impurity N59