CAS 1246636-79-2 appears in our catalog under these names: Methyl 2-(4-((6-chloropyrimidin-4-yl)oxy)phenyl)acetate, 95%, Methyl 2–(4–(6–chloropyrimidin–4–yloxy)phenyl)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-[4-(6-chloropyrimidin-4-yl)oxyphenyl]acetate (CAS 1246636-79-2) is a chemical compound with the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. IUPAC name: methyl 2-[4-(6-chloropyrimidin-4-yl)oxyphenyl]acetate. InChIKey: NGOZQBYSVAZWAZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | methyl 2-[4-(6-chloropyrimidin-4-yl)oxyphenyl]acetate |
| InChIKey | NGOZQBYSVAZWAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)OC2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)