Products 2782812-46-6
CAS 2782812-46-6 appears in our catalog under these names: 2'-Chloro-5'-methoxy-6-methyl-[4,4'-bipyridine]-3-carboxylic acid, 98%, 2'-Chloro-5'-methoxy-6-methyl-[4,4'-bipyridine]-3-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylic acid (CAS 2782812-46-6) is a chemical compound with the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. IUPAC name: 4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylic acid. InChIKey: MGCAZYXTPDSVGZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxylic acid |
| InChIKey | MGCAZYXTPDSVGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)C(=O)O)C2=CC(=NC=C2OC)Cl |
Computed by PubChem (NCBI)