CAS 339030-49-8 is the registry number for Ethyl 4-chloro-6-oxo-1-phenyl-1,6-dihydro-3-pyridazinecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4-chloro-6-oxo-1-phenylpyridazine-3-carboxylate (CAS 339030-49-8) is a chemical compound with the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. IUPAC name: ethyl 4-chloro-6-oxo-1-phenylpyridazine-3-carboxylate. InChIKey: FVICQWSLDJJNGH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | ethyl 4-chloro-6-oxo-1-phenylpyridazine-3-carboxylate |
| InChIKey | FVICQWSLDJJNGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=O)C=C1Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)