Products 1246815-60-0
CAS 1246815-60-0 is the registry number for 4-(2-(1-Piperidinyl)ethoxy-d4)benzoic Acid, Hydrochloride Salt. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-(1,1,2,2-tetradeuterio-2-piperidin-1-ylethoxy)benzoic acid;hydrochloride (CAS 1246815-60-0) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 289.79 g/mol. IUPAC name: 4-(1,1,2,2-tetradeuterio-2-piperidin-1-ylethoxy)benzoic acid;hydrochloride. InChIKey: CMVTYSMYHSVDIU-DEHBLRELSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 289.79 g/mol |
| IUPAC name | 4-(1,1,2,2-tetradeuterio-2-piperidin-1-ylethoxy)benzoic acid;hydrochloride |
| InChIKey | CMVTYSMYHSVDIU-DEHBLRELSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=C(C=C1)C(=O)O)N2CCCCC2.Cl |
Computed by PubChem (NCBI)