Products 1246815-92-8
CAS 1246815-92-8 appears in our catalog under these names: Pyrimido(1,2-a)purin-10(1H)-one-13C3, Pyrimido[1,2-a]purin-10(1H)-one-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1H-(4,5,6-13C3)pyrimidino[1,2-a]purin-10-one (CAS 1246815-92-8) is a chemical compound with the molecular formula C8H5N5O and a molecular weight of 190.14 g/mol. IUPAC name: 1H-(4,5,6-13C3)pyrimidino[1,2-a]purin-10-one. InChIKey: ZREGNVKUSNORFO-VMIGTVKRSA-N.
| Molecular formula | C8H5N5O |
|---|---|
| Molecular weight | 190.14 g/mol |
| IUPAC name | 1H-(4,5,6-13C3)pyrimidino[1,2-a]purin-10-one |
| InChIKey | ZREGNVKUSNORFO-VMIGTVKRSA-N |
| SMILES | C1=NC2=C(N1)C(=O)N3[13CH]=[13CH][13CH]=NC3=N2 |
Computed by PubChem (NCBI)