CAS 851043-72-6 is the registry number for Pyrido[3,2-e][1,2,4]triazolo[4,3-a]pyrazin-6(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (CAS 851043-72-6) is a chemical compound with the molecular formula C8H5N5O and a molecular weight of 187.16 g/mol. IUPAC name: 2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one. InChIKey: CJESIEBQEDSKIT-UHFFFAOYSA-N.
| Molecular formula | C8H5N5O |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| InChIKey | CJESIEBQEDSKIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N3C=NN=C3C(=O)N2 |
Computed by PubChem (NCBI)