CAS 932233-33-5 is the registry number for Pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (CAS 932233-33-5) is a chemical compound with the molecular formula C8H5N5O and a molecular weight of 187.16 g/mol. IUPAC name: 2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one. InChIKey: NOTICOWTACQVJS-UHFFFAOYSA-N.
| Molecular formula | C8H5N5O |
|---|---|
| Molecular weight | 187.16 g/mol |
| IUPAC name | 2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| InChIKey | NOTICOWTACQVJS-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1N3C(=NC=N3)N=C2 |
Computed by PubChem (NCBI)