CAS 1246816-42-1 appears in our catalog under these names: 2-Methyl-6-nitroaniline-d3, 2-(Methyl-d3)-6-nitroaniline. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-nitro-6-(trideuteriomethyl)aniline (CAS 1246816-42-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 155.17 g/mol. IUPAC name: 2-nitro-6-(trideuteriomethyl)aniline. InChIKey: FCMRHMPITHLLLA-FIBGUPNXSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 2-nitro-6-(trideuteriomethyl)aniline |
| InChIKey | FCMRHMPITHLLLA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)