CAS 570-24-1 appears in our catalog under these names: 2-Methyl-6-nitroaniline, 2-Amino-3-nitrotoluene, 2–Methyl–6–nitroaniline, 2-Methyl-6-nitroaniline, 98% , 2-Methyl-6-nitroaniline, >99.0%(GC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 25g, 5g, 250mg, 100g, 500g, 50g, 250g.
2-methyl-6-nitroaniline (CAS 570-24-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2-methyl-6-nitroaniline. InChIKey: FCMRHMPITHLLLA-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2-methyl-6-nitroaniline |
| InChIKey | FCMRHMPITHLLLA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)