CAS 1246816-67-0 appears in our catalog under these names: 4-Hydrazinobenzoic Acid-d4 Hydrochloride, 4-Hydrazinylbenzoic acid hydrochloride-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
2,3,5,6-tetradeuterio-4-hydrazinylbenzoic acid;hydrochloride (CAS 1246816-67-0) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 192.63 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-hydrazinylbenzoic acid;hydrochloride. InChIKey: XHLQMKQBCHYRLC-FOMJDCLLSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 192.63 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | XHLQMKQBCHYRLC-FOMJDCLLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])NN)[2H].Cl |
Computed by PubChem (NCBI)