Products 1246817-31-1
CAS 1246817-31-1 is the registry number for Glutaric Acid-2-methylamino-5-nitromonoanilide-d3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-[5-nitro-2-(trideuteriomethylamino)anilino]-5-oxopentanoic acid (CAS 1246817-31-1) is a chemical compound with the molecular formula C12H15N3O5 and a molecular weight of 284.28 g/mol. IUPAC name: 5-[5-nitro-2-(trideuteriomethylamino)anilino]-5-oxopentanoic acid. InChIKey: IEBOWQSCVIKQHZ-FIBGUPNXSA-N.
| Molecular formula | C12H15N3O5 |
|---|---|
| Molecular weight | 284.28 g/mol |
| IUPAC name | 5-[5-nitro-2-(trideuteriomethylamino)anilino]-5-oxopentanoic acid |
| InChIKey | IEBOWQSCVIKQHZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)