Products 1797130-34-7

CAS 1797130-34-7 is the registry number for N-Aminocarbonyl Felbamate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(3-carbamoyloxy-2-phenylpropyl) N-carbamoylcarbamate (CAS 1797130-34-7) is a chemical compound with the molecular formula C12H15N3O5 and a molecular weight of 281.26 g/mol. IUPAC name: (3-carbamoyloxy-2-phenylpropyl) N-carbamoylcarbamate. InChIKey: KTXILZWNONXFCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15N3O5
Molecular weight281.26 g/mol
IUPAC name(3-carbamoyloxy-2-phenylpropyl) N-carbamoylcarbamate
InChIKeyKTXILZWNONXFCQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(COC(=O)N)COC(=O)NC(=O)N

Computed by PubChem (NCBI)