CAS 91644-13-2 appears in our catalog under these names: Bendamustine Impurity 13, Glutaric acid-2-methylamino-5-nitromonoanilide, 96%, 96%, 5–((2–(Methylamino)–5–nitrophenyl)amino)–5–oxopentanoic acid, 5-((2-(Methylamino)-5-nitrophenyl)amino)-5-oxopentanoic acid. Offered by: Chemat Brand, Chemat, GLPBio, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g.
5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid (CAS 91644-13-2) is a chemical compound with the molecular formula C12H15N3O5 and a molecular weight of 281.26 g/mol. IUPAC name: 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid. InChIKey: IEBOWQSCVIKQHZ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O5 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 5-[2-(methylamino)-5-nitroanilino]-5-oxopentanoic acid |
| InChIKey | IEBOWQSCVIKQHZ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)