Products 1246818-57-4
CAS 1246818-57-4 is the registry number for rac 10-Hydroxy-1-undecen-6-one-d6. Offered by: TRC. Available pack sizes: 100mg, 10mg.
9,9,10,11,11,11-hexadeuterio-10-hydroxyundec-1-en-6-one (CAS 1246818-57-4) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 190.31 g/mol. IUPAC name: 9,9,10,11,11,11-hexadeuterio-10-hydroxyundec-1-en-6-one. InChIKey: QOQZFWWLTAMSDW-AYNFZVKDSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 190.31 g/mol |
| IUPAC name | 9,9,10,11,11,11-hexadeuterio-10-hydroxyundec-1-en-6-one |
| InChIKey | QOQZFWWLTAMSDW-AYNFZVKDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])CCC(=O)CCCC=C)O |
Computed by PubChem (NCBI)
Synonyms:
rac 10-Hydroxy-1-undecen-6-one-d6