Products 1246818-61-0
CAS 1246818-61-0 appears in our catalog under these names: 2-Benzylamino-2-phenylbutanol-d5, 2–Benzylamino–2–phenylbutanol–d5, 2-(Benzylamino)-2-phenylbutan-1-ol-d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 100mg, 50 mg, 5 mg.
2-(benzylamino)-3,3,4,4,4-pentadeuterio-2-phenylbutan-1-ol (CAS 1246818-61-0) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 260.38 g/mol. IUPAC name: 2-(benzylamino)-3,3,4,4,4-pentadeuterio-2-phenylbutan-1-ol. InChIKey: YUWOWSIPHMTMCC-ZBJDZAJPSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 260.38 g/mol |
| IUPAC name | 2-(benzylamino)-3,3,4,4,4-pentadeuterio-2-phenylbutan-1-ol |
| InChIKey | YUWOWSIPHMTMCC-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(CO)(C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)